Sauchinone A
(1S,12R,13S,14R,16R,23S)-13,14-dimethyl-2,6,8,20,22-pentaoxahexacyclo[10.10.1.01,19.03,11.05,9.016,23]tricosa-3,5(9),10,18-tetraen-17-one
Also Known As: sauchinone A|J1.375.888C|(1S,12R,13S,14R,16R,23S)-13,14-dimethyl-2,6,8,20,22-pentaoxahexacyclo[10.10.1.01,19.03,11.05,9.016,23]tricosa-3,5(9),10,18-tetraen-17-one|(14aS)-5abeta,6,7,8,8aalpha,14bbeta-Hexahydro-7beta,8alpha-dimethyl-5H-benzo[kl]bis[1,3]dioxolo[4,5-b:4 ,5 -g]xanthene-5-one|(1S,12R,13S,14R,16R,23S)-13,14-dimethyl-2,6,8,20,22-pentaoxahexacyclo(10.10.1.01,19.03,11.05,9.016,23)tricosa-3,5(9),10,18-tetraen-17-one
| Molecular Formula | C20H20O6 |
|---|---|
| Molecular Weight | 356.12598 g/mol |
| LogP | 2.9668 |
| Topological Polar Surface Area | 63.22 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 0 |
| Exact Mass | 356.12598 |
| Monoisotopic Mass | 356.12598 |
| Heavy Atoms | 26 |
| Complexity | 860.10254 |
Chemical Identifiers
| CAS Number | 26430-34-2 |
|---|---|
| SMILES | C[C@@H]1C[C@@H]2[C@@H]3[C@@H]([C@H]1C)C4=CC5=C(C=C4O[C@@]36C(=CC2=O)OCO6)OCO5 |
Product Overview
Sauchinone A (CAS 26430-34-2), with molecular formula C20H20O6 and molecular weight 356.12598 g/mol. IUPAC: (1S,12R,13S,14R,16R,23S)-13,14-dimethyl-2,6,8,20,22-pentaoxahexacyclo[10.10.1.01,19.03,11.05,9.016,23]tricosa-3,5(9),10,18-tetraen-17-one.