Methyl methacrylate 2-hydroxyethyl methacrylate
2-hydroxyethyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate
Also Known As: HTR composite|Poly(HEMA-co-MMA)|Hema methyl methacrylate|Hard tissue replacement composite|(C6-H10-O3.C5-H8-O2)x-|methyl methacrylate 2-hydroxyethyl methacrylate|Hydroxyethyl methacrylate-methyl methacrylate polymer|2-Propenoic acid, 2-methyl-, 2-hydroxyethyl ester, polymer with methyl 2-methyl-2-propenoate|Poly(2-hydroxyethyl methacrylate-methyl methacrylate)|2-hydroxyethyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate|2-hydroxyethyl 2-methylprop-2-enoate- methyl 2-methylprop-2-enoate(1:1)|2-hydroxyethyl 2-methylprop-2-enoate; methyl 2-methylprop-2-enoate
| Molecular Formula | C11H18O5 |
|---|---|
| Molecular Weight | 230.11542 g/mol |
| LogP | 0.8335 |
| Topological Polar Surface Area | 72.8 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Exact Mass | 230.11542 |
| Monoisotopic Mass | 230.11542 |
| Heavy Atoms | 16 |
| Complexity | 212.0 |
Chemical Identifiers
| CAS Number | 27232-75-3 |
|---|---|
| SMILES | CC(=C)C(=O)OC.CC(=C)C(=O)OCCO |
| InChIKey | DICULBYFSUXYAH-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 16 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Methyl methacrylate 2-hydroxyethyl methacrylate (CAS 27232-75-3), with molecular formula C11H18O5 and molecular weight 230.11542 g/mol. IUPAC: 2-hydroxyethyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate.