![Acetamide, N-[2-(4-hydroxyphenyl)-1-methylethyl]- structure](/static/products/2767/27675-95-2.webp)
Acetamide, N-[2-(4-hydroxyphenyl)-1-methylethyl]-
N-[1-(4-hydroxyphenyl)propan-2-yl]acetamide
Also Known As: Acetamide, N-[2-(4-hydroxyphenyl)-1-methylethyl]-|4-Hydroxyamphetamine-N-acetyl|N-Acetyl-4-hydroxyamphetamine|4-Hydroxyamphetamine, N-acetyl|N-[1-(4-hydroxyphenyl)propan-2-yl]acetamide|N-(4-Hydroxy-alpha-methylphenethyl)acetamide|N-(alpha-Methyl-4-hydroxyphenethyl)acetamide|N-[2-(4-Hydroxyphenyl)-1-methylethyl]acetamide|N-[2-(4-Hydroxy-phenyl)-1-methyl-ethyl]-acetamide|N-[2-(4-Hydroxyphenyl)-1-methylethyl]acetamide #
| Molecular Formula | C11H15NO2 |
|---|---|
| Molecular Weight | 193.11028 g/mol |
| LogP | 1.6 |
| Topological Polar Surface Area | 49.3 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 193.11028 |
| Monoisotopic Mass | 193.11028 |
| Heavy Atoms | 14 |
| Complexity | 186.0 |
Chemical Identifiers
| CAS Number | 27675-95-2 |
|---|---|
| SMILES | CC(CC1=CC=C(C=C1)O)NC(=O)C |
| InChIKey | ZBLINTGLDYSGCA-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Acetamide, N-[2-(4-hydroxyphenyl)-1-methylethyl]- (CAS 27675-95-2), with molecular formula C11H15NO2 and molecular weight 193.11028 g/mol. IUPAC: N-[1-(4-hydroxyphenyl)propan-2-yl]acetamide.
Acetamide, N-[2-(4-hydroxyphenyl)-1-methylethyl]- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »