(4-Bromophenyl)trichlorosilane
(4-bromophenyl)-trichlorosilane
Also Known As: (4-bromophenyl)trichlorosilane|(4-bromophenyl)-trichlorosilane|Bromophenyltrichlorosilane|4-bromophenyltrichlorosilane|Trichloro(4-bromophenyl)silane|(4-Bromophenyl)(trichloro)silane|(4-bromophenyl)-trichloro-silane|(4-Bromophenyl)tri(chloro)silane|Silane, (4-bromophenyl)trichloro-|Benzene, 1-bromo-4-(trichlorosilyl)-|J1.786.297I|2-(trifluoroacetyl)-1,2,3,4-tetrahydro-7-isoquinolinamine
| Molecular Formula | C6H4BrCl3Si |
|---|---|
| Molecular Weight | 287.83313 g/mol |
| LogP | 3.3114 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 0 |
| Exact Mass | 287.83313 |
| Monoisotopic Mass | 287.83313 |
| Heavy Atoms | 11 |
| Complexity | 128.0 |
Chemical Identifiers
| CAS Number | 27752-77-8 |
|---|---|
| SMILES | C1=CC(=CC=C1[Si](Cl)(Cl)Cl)Br |
| InChIKey | WODNGFYRYQNMEO-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
(4-Bromophenyl)trichlorosilane (CAS 27752-77-8), with molecular formula C6H4BrCl3Si and molecular weight 287.83313 g/mol. IUPAC: (4-bromophenyl)-trichlorosilane.
(4-Bromophenyl)trichlorosilane is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »