Dehydroilludin M
5'-hydroxy-2',2',5',7'-tetramethylspiro[cyclopropane-1,6'-indene]-1',4'-dione
Also Known As: Dehydroilludin M|6'-hydroxy-2',2',4',6'-tetramethylspiro[cyclopropane-1,5'-indene]-3',7'(2'H,6'H)-dione|5'-hydroxy-2',2',5',7'-tetramethyl-spiro[cyclopropane-1,6'-indene]-1',4'-dione|5'-hydroxy-2',2',5',7'-tetramethylspiro[cyclopropane-1,6'-indene]-1',4'-dione|Spiro[cyclopropane-1,5'-[5H]indene]-3',7'(2'H,6'H)-dione, 6'-hydroxy-2',2',4',6'-tetramethyl-
| Molecular Formula | C15H18O3 |
|---|---|
| Molecular Weight | 246.1256 g/mol |
| LogP | 1.3 |
| Topological Polar Surface Area | 54.4 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 0 |
| Exact Mass | 246.1256 |
| Monoisotopic Mass | 246.1256 |
| Heavy Atoms | 18 |
| Complexity | 558.0 |
Chemical Identifiers
| CAS Number | 28282-65-7 |
|---|---|
| SMILES | CC1=C2C(=CC(C2=O)(C)C)C(=O)C(C13CC3)(C)O |
| InChIKey | PFURRCFDDZMGLA-UHFFFAOYSA-N |
Product Overview
Dehydroilludin M (CAS 28282-65-7), with molecular formula C15H18O3 and molecular weight 246.1256 g/mol. IUPAC: 5'-hydroxy-2',2',5',7'-tetramethylspiro[cyclopropane-1,6'-indene]-1',4'-dione.
Dehydroilludin M is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »