CCRIS 7424
(1aS,9bS)-1a,1b,2,3,4,5,5a,9b-octahydrophenanthro[9,10-b]oxirene
Also Known As: (4abeta,9alpha,10alpha)-9,10-Epoxy-trans-1,2,3,4,4a,9,10,10a-octahydrophenanthrene|syn-trans-9,10-Epoxy-1,2,3,4,4a,9,10,10a-octahydrophenanthrene|(4abeta,9beta,10beta)-9,10-Epoxy-trans-1,2,3,4,4a,9,10,10a-octahydrophenanthrene|anti-trans-9,10-Epoxy-1,2,3,4,4a,9,10,10a-octahydrophenanthrene|Phenanthrene, 9,10-epoxy-1,2,3,4,4a,9,10,10a-octahydro-, anti-trans-|Phenanthrene, 9,10-epoxy-1,2,3,4,4a,9,10,10a-octahydro-, syn-trans-|(1aS,9bS)-1a,1b,2,3,4,5,5a,9b-octahydrophenanthro[9,10-b]oxirene|1a,1b,2,3,4,5,5a,9b-Octahydrophenanthro[9,10-b]oxirene
| Molecular Formula | C14H16O |
|---|---|
| Molecular Weight | 200.12012 g/mol |
| LogP | 3.3 |
| Topological Polar Surface Area | 12.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 0 |
| Exact Mass | 200.12012 |
| Monoisotopic Mass | 200.12012 |
| Heavy Atoms | 15 |
| Complexity | 262.0 |
Chemical Identifiers
| CAS Number | 28352-34-3 |
|---|---|
| SMILES | C1CCC2C(C1)[C@H]3[C@@H](O3)C4=CC=CC=C24 |
| InChIKey | DDUOSWOYLIPSOQ-FFKWVLBGSA-N |
Product Overview
CCRIS 7424 (CAS 28352-34-3), with molecular formula C14H16O and molecular weight 200.12012 g/mol. IUPAC: (1aS,9bS)-1a,1b,2,3,4,5,5a,9b-octahydrophenanthro[9,10-b]oxirene.