3-(Diphenylphosphino)propionic acid
3-diphenylphosphanylpropanoic acid
Also Known As: 3-(DIPHENYLPHOSPHINO)PROPIONIC ACID|3-(diphenylphosphino)-propanoic acid|ACMC-20anip|Propanoic acid, 3-(diphenylphosphino)-|3-diphenylphosphanylpropanoic Acid|3-(diphenylphosphanyl)propanoic acid|3-(diphenylphosphino)propanoic acid|(2-Carboxyethyl)diphenylphosphine|3-(diphenylphosphino)-propanoicacid|4,4-Diphenyl-4-phosphabutanoic acid|3-(Diphenylphosphino)propionic acid, 97%|J2.480.966H|10.14272/OTSIFUHGOBFOTH-UHFFFAOYSA-N|doi:10.14272/OTSIFUHGOBFOTH-UHFFFAOYSA-N|(2-Carboxyethyl)diphenylphosphine, 4,4-Diphenyl-4-phosphabutanoic acid
| Molecular Formula | C15H15O2P |
|---|---|
| Molecular Weight | 258.08096 g/mol |
| LogP | 2.594 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Exact Mass | 258.08096 |
| Monoisotopic Mass | 258.08096 |
| Heavy Atoms | 18 |
| Complexity | 456.91675 |
Chemical Identifiers
| CAS Number | 2848-01-3 |
|---|---|
| SMILES | C1=CC=C(C=C1)P(CCC(=O)O)C2=CC=CC=C2 |
Product Overview
3-(Diphenylphosphino)propionic acid (CAS 2848-01-3), with molecular formula C15H15O2P and molecular weight 258.08096 g/mol. IUPAC: 3-diphenylphosphanylpropanoic acid.