4-Benzenesulfonamidobenzoic acid
4-(benzenesulfonamido)benzoic acid
Also Known As: 4-Benzenesulfonylaminobenzoic acid|4-(Phenylsulfonamido)benzoic acid|4-[(Phenylsulfonyl)amino]benzoic acid|4-(benzenesulfonamido)benzoic acid|4-benzenesulfonamidobenzoic acid|Benzoic acid, 4-[(phenylsulfonyl)amino]-|p-(Phenylsulfamoyl)benzoic acid|Oprea1_014846|Oprea1_337875|ACMC-209h33|4-Benzenesulfonylamino-benzoic acid|4-(Phenylsulfonamido)benzoicacid|4-phenylsulfonylaminobenzoic acid|4-BENZENESULFONYLAMINOBENZOICACID|benzoic acid, 4-phenylsulfonylamino-|4-[(Phenylsulfonyl)amino]benzoic acid #|Benzoic acid,4-[(phenylsulfonyl)amino]-|BAS 00116563|BB 0248097|J2.106.410F
| Molecular Formula | C13H11NO4S |
|---|---|
| Molecular Weight | 277.0409 g/mol |
| LogP | 1.8 |
| Topological Polar Surface Area | 91.9 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 277.0409 |
| Monoisotopic Mass | 277.0409 |
| Heavy Atoms | 19 |
| Complexity | 401.0 |
Chemical Identifiers
| CAS Number | 28547-16-2 |
|---|---|
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)C(=O)O |
| InChIKey | YAGOYAVZOJQMRT-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 6 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4-Benzenesulfonamidobenzoic acid (CAS 28547-16-2), with molecular formula C13H11NO4S and molecular weight 277.0409 g/mol. IUPAC: 4-(benzenesulfonamido)benzoic acid.