Orientin
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one
Also Known As: Orientin|Lutexin|Orientine|Luteolin 8-C-glucoside|Luteolin-8-glucoside|Luteolin 8-glucoside|Orientin (Flavone)|Luteolin-8-C-glucoside|8-glucosylluteolin|Orientin,Lutexin|Orientin[flavone]|Orientin (Standard)|8-beta-D-glucosylluteolin|8-C-Glucosylluteolin|Luteolin 8-C-glucosid|4-Carboxyphenylboronic acid|MASSBANK PR020063|luteolin 8-C-glucopyranoside|Orientin, analytical standard|Luteolin 8-C-beta-D-glucopyranoside|Orientin, >=97% (HPLC)|HY-N0405R|Luteolin 8-C-b-D-glucopyranoside|NIAID AIDS# 026706|ORIENTIN (REFERENCE GRADE)|HY-N0405|KS-00000YH0|Luteolin 8-C-|A-D-glucopyranoside
| Molecular Formula | C21H20O11 |
|---|---|
| Molecular Weight | 448.10056 g/mol |
| LogP | -0.2027 |
| Topological Polar Surface Area | 201.28 Ų |
| Hydrogen Bond Donors | 8 |
| Hydrogen Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Exact Mass | 448.10056 |
| Monoisotopic Mass | 448.10056 |
| Heavy Atoms | 32 |
| Complexity | 1232.6235 |
Chemical Identifiers
| CAS Number | 28608-75-5 |
|---|---|
| SMILES | C1=CC(=C(C=C1C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O |
Product Overview
Orientin (CAS 28608-75-5), with molecular formula C21H20O11 and molecular weight 448.10056 g/mol. IUPAC: 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one.