Ethane-1,2-diamine;formaldehyde;phenol
ethane-1,2-diamine;formaldehyde;phenol
Also Known As: Ethylenediamine-phenol-formaldehyde polymer|Ethylenediamine-formaldehyde-phenol copolymer|Formaldehyde-ethylenediamine-phenol copolymer|ethane-1,2-diamine; formaldehyde; phenol|(C6-H6-O.C2-H8-N2.C-H2-O)x-|Formaldehyde, polymer with 1,2-ethanediamine and phenol|Ethylenediamine, polymer with formaldehyde and phenol|1,2-Ethanediamine, polymer with formaldehyde and phenol|1,2-Ethanediamine, polymer with formaldehyde and phenol (9CI)|Phenol, polymer with 1,2-ethanediamine and formaldehyde|Phenol condensation products, with ethylenediamine and formaldehyde
| Molecular Formula | C9H16N2O2 |
|---|---|
| Molecular Weight | 184.12119 g/mol |
| LogP | 0.1111 |
| Topological Polar Surface Area | 89.3 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Exact Mass | 184.12119 |
| Monoisotopic Mass | 184.12119 |
| Heavy Atoms | 13 |
| Complexity | 54.0 |
Chemical Identifiers
| CAS Number | 28985-91-3 |
|---|---|
| SMILES | C=O.C1=CC=C(C=C1)O.C(CN)N |
| InChIKey | YYPGCBVYFIBLEV-UHFFFAOYSA-N |
Product Overview
Ethane-1,2-diamine;formaldehyde;phenol (CAS 28985-91-3), with molecular formula C9H16N2O2 and molecular weight 184.12119 g/mol. IUPAC: ethane-1,2-diamine;formaldehyde;phenol.