Benzenamine, 3-chloro-N-(2-pyridinylmethylene)-
N-(3-chlorophenyl)-1-pyridin-2-ylmethanimine
Also Known As: Benzenamine, 3-chloro-N-(2-pyridinylmethylene)-|Pyridine, 2-[N-(m-chlorophenyl)formimidoyl]-|2-[[(3-Chlorophenyl)imino]methyl]pyridine|N-(3-Chlorophenyl)-2-pyridylmethyleneamine|3-chloro-N-(pyridin-2-ylmethylidene)aniline|3-Chloro-N-(2-pyridinylmethylene)benzenamine|N-(3-chlorophenyl)-1-pyridin-2-ylmethanimine|N-(3-chlorophenyl)-1-(pyridin-2-yl)methanimine|3-Chloro-N-[(E)-2-pyridinylmethylidene]aniline #|(E)-N-(3-Chlorophenyl)-1-(pyridin-2-yl)methanimine
| Molecular Formula | C12H9ClN2 |
|---|---|
| Molecular Weight | 216.04543 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 25.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 216.04543 |
| Monoisotopic Mass | 216.04543 |
| Heavy Atoms | 15 |
| Complexity | 218.0 |
Chemical Identifiers
| CAS Number | 29202-16-2 |
|---|---|
| SMILES | C1=CC=NC(=C1)C=NC2=CC(=CC=C2)Cl |
| InChIKey | XXYAOHIZGLTMAM-UHFFFAOYSA-N |
Product Overview
Benzenamine, 3-chloro-N-(2-pyridinylmethylene)- (CAS 29202-16-2), with molecular formula C12H9ClN2 and molecular weight 216.04543 g/mol. IUPAC: N-(3-chlorophenyl)-1-pyridin-2-ylmethanimine.
Benzenamine, 3-chloro-N-(2-pyridinylmethylene)- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »