Chloroethene;1,1-dichloroethene;2-ethylhexyl prop-2-enoate
chloroethene;1,1-dichloroethene;2-ethylhexyl prop-2-enoate
Also Known As: (C11-H20-O2.C2-H3-Cl.C2-H2-Cl2)x-|Chloroethene, 1,1-dichloroethene, 2-ethylhexyl 2-propenoate polymer|2-Propenoic acid, 2-ethylhexyl ester, polymer with chloroethene and 1,1-dichloroethene|chloroethylene; 1,1-dichloroethylene; 2-ethylhexyl prop-2-enoate|Chloroethene, polymer with 1,1-dichloroethene and 2-ethylhexyl 2-propenoate|chloroethene; 1,1-dichloroethene; 2-ethylhexyl prop-2-enoate|2-Propenoic acid, 2-ethylhexyl ester, polymer with chloroethene and1,1-dichloroethene
| Molecular Formula | C15H25Cl3O2 |
|---|---|
| Molecular Weight | 342.092 g/mol |
| LogP | 6.2359 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Exact Mass | 342.092 |
| Monoisotopic Mass | 342.092 |
| Heavy Atoms | 20 |
| Complexity | 189.0 |
Chemical Identifiers
| CAS Number | 2950-39-2 |
|---|---|
| SMILES | CCCCC(CC)COC(=O)C=C.C=CCl.C=C(Cl)Cl |
| InChIKey | JRJFGRSOLABEIG-UHFFFAOYSA-N |
Product Overview
Chloroethene;1,1-dichloroethene;2-ethylhexyl prop-2-enoate (CAS 2950-39-2), with molecular formula C15H25Cl3O2 and molecular weight 342.092 g/mol. IUPAC: chloroethene;1,1-dichloroethene;2-ethylhexyl prop-2-enoate.