Phthaloyl-L-Leucine
(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoic acid
Also Known As: Phthaloyl-L-Leucine|D-phthleucine|Pht-L-Leu-OH|PHT-LEU-OH|N-Phthaloyl-D-leucine|(2r)-2-(1,3-dioxo-2,3-dihydro-1h-isoindol-2-yl)-4-methylpentanoic acid|(R)-2-Phthalimidyl-4-methylpentanoic acid|J1.249.302I|(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoic acid|1H-Imidazole, 4,5-dihydro-2-(3-methylphenyl)-|(2R)-2-(1,3-dioxoisoindolin-2-yl)-4-methyl-pentanoic acid|(2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoic acid|(alphaR)-alpha-Isobutyl-1,3-dioxo-2,3-dihydro-1H-isoindole-2-acetic acid|2-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)-4-methylpentanoic acid
| Molecular Formula | C14H15NO4 |
|---|---|
| Molecular Weight | 261.1001 g/mol |
| LogP | 2.2 |
| Topological Polar Surface Area | 74.7 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 261.1001 |
| Monoisotopic Mass | 261.1001 |
| Heavy Atoms | 19 |
| Complexity | 380.0 |
Chemical Identifiers
| CAS Number | 29588-87-2 |
|---|---|
| SMILES | CC(C)C[C@H](C(=O)O)N1C(=O)C2=CC=CC=C2C1=O |
| InChIKey | RMOSZIHTPMEZAP-LLVKDONJSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Phthaloyl-L-Leucine (CAS 29588-87-2), with molecular formula C14H15NO4 and molecular weight 261.1001 g/mol. IUPAC: (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoic acid.