6,6'-Dimethoxy-2,2'-binaphthalenyl
2-methoxy-6-(6-methoxynaphthalen-2-yl)naphthalene
Also Known As: 6,6'-Dimethoxy-2,2'-binaphthalene|Nabumetone EP Impurity F|6,6'-Dimethoxy-2,2'-binaphthalenyl|Nabumetone impurity F|Nabumetone Impurity 4|Nabumetone impurity F CRS|Nabumetone specified impurity F|2,2'-Binaphthalene, 6,6'-dimethoxy-|Nabumetone specified impurity F [EP]|6,6-Dimethoxy-2,2-binaphthalene|2,2 -Bi[6-methoxynaphthalene]|2-methoxy-6-(6-methoxynaphthalen-2-yl)naphthalene|NABUMETONE IMPURITY F [EP IMPURITY]|6,6/'-Dimethoxy-2,2/'-binaphthalenyl|6,6 -Dimethoxy-2,2 -binaphthalene|6,6'-DIMETHOXY-2,2'-BINAPHTHYL|Nabumetone Impurity F CRS (N0020030)|NABUMETONE IMPURITY F (EP IMPURITY)|O(C)c1ccc2cc(ccc2c1)c3ccc4cc(OC)ccc4c3|J1.454.961G|Nabumetone impurity, 6,6-dimethoxy-2,2'-binaphthyl- [USP]|Nabumetone impurity, 6,6-dimethoxy-2,2'-binaphthyl-(USP)|Nabumetone impurity, 6,6-dimethoxy-2,2'-binaphthyl-[USP]|NABUMETONE IMPURITY, 6,6-DIMETHOXY-2,2'-BINAPHTHYL- [USP IMPURITY]|NABUMETONE IMPURITY, 6,6-DIMETHOXY-2,2'-BINAPHTHYL-(USP IMPURITY)|NABUMETONE IMPURITY, 6,6-DIMETHOXY-2,2'-BINAPHTHYL-[USP IMPURITY]|6,6'-Dimethoxy-2,2'-binaphthalenyl; Nabumetone Imp. F (EP); Nabumetone Impurity F
| Molecular Formula | C22H18O2 |
|---|---|
| Molecular Weight | 314.13068 g/mol |
| LogP | 6.0 |
| Topological Polar Surface Area | 18.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 314.13068 |
| Monoisotopic Mass | 314.13068 |
| Heavy Atoms | 24 |
| Complexity | 371.0 |
Chemical Identifiers
| CAS Number | 29619-45-2 |
|---|---|
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)C3=CC4=C(C=C3)C=C(C=C4)OC |
| InChIKey | FYVICNOBWLSECU-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
6,6'-Dimethoxy-2,2'-binaphthalenyl (CAS 29619-45-2), with molecular formula C22H18O2 and molecular weight 314.13068 g/mol. IUPAC: 2-methoxy-6-(6-methoxynaphthalen-2-yl)naphthalene.