3-(2-Piperidin-1-yl-acetylamino)-1H-indole-2-carboxylic acid ethyl ester
ethyl 3-[(2-piperidin-1-ylacetyl)amino]-1H-indole-2-carboxylate
Also Known As: BAS 00703263|3-(2-Piperidin-1-yl-acetylamino)-1H-indole-2-carboxylic acid ethyl ester|ethyl 3-[(2-piperidin-1-ylacetyl)amino]-1H-indole-2-carboxylate|AG-690/37122001|ethyl 3-(2-piperidylacetylamino)indole-2-carboxylate|ethyl 3-(2-(piperidin-1-yl)acetamido)-1H-indole-2-carboxylate|ethyl 3-[(1-piperidinylacetyl)amino]-1H-indole-2-carboxylate|ethyl 3-[(piperidin-1-ylacetyl)amino]-1H-indole-2-carboxylate|ETHYL 3-[2-(PIPERIDIN-1-YL)ACETAMIDO]-1H-INDOLE-2-CARBOXYLATE|3-[[1-oxo-2-(1-piperidinyl)ethyl]amino]-1H-indole-2-carboxylic acid ethyl ester
| Molecular Formula | C18H23N3O3 |
|---|---|
| Molecular Weight | 329.17395 g/mol |
| LogP | 3.2 |
| Topological Polar Surface Area | 74.4 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Exact Mass | 329.17395 |
| Monoisotopic Mass | 329.17395 |
| Heavy Atoms | 24 |
| Complexity | 451.0 |
Chemical Identifiers
| CAS Number | 296263-91-7 |
|---|---|
| SMILES | CCOC(=O)C1=C(C2=CC=CC=C2N1)NC(=O)CN3CCCCC3 |
| InChIKey | CUMOULPJLKYRTG-UHFFFAOYSA-N |
Product Overview
3-(2-Piperidin-1-yl-acetylamino)-1H-indole-2-carboxylic acid ethyl ester (CAS 296263-91-7), with molecular formula C18H23N3O3 and molecular weight 329.17395 g/mol. IUPAC: ethyl 3-[(2-piperidin-1-ylacetyl)amino]-1H-indole-2-carboxylate.