![(6E)-6-[(2-nitroanilino)methylidene]cyclohexa-2,4-dien-1-one structure](/static/products/2964/29644-79-9.webp)
(6E)-6-[(2-nitroanilino)methylidene]cyclohexa-2,4-dien-1-one
2-[(2-nitrophenyl)iminomethyl]phenol
Also Known As: NCIOpen2_007037|CBDivE_000757|2-(2-Nitrophenyliminomethyl)phenol|2-[(2-Nitrophenylimino)methyl]phenol|2-{[(2-nitrophenyl)imino]methyl}phenol|2-[(E)-(2-nitrophenyl)iminomethyl]phenol|J1.940.236C|(6E)-6-[(2-nitroanilino)methylidene]cyclohexa-2,4-dien-1-one|2-(((2-(Hydroxy(oxido)amino)phenyl)imino)methyl)phenol|6-[(2-nitroanilino)methylidene]cyclohexa-2,4-dien-1-one|(6Z)-6-[(2-nitroanilino)methylidene]cyclohexa-2,4-dien-1-one
| Molecular Formula | C13H10N2O3 |
|---|---|
| Molecular Weight | 242.06914 g/mol |
| LogP | 2.9 |
| Topological Polar Surface Area | 78.4 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 242.06914 |
| Monoisotopic Mass | 242.06914 |
| Heavy Atoms | 18 |
| Complexity | 314.0 |
Chemical Identifiers
| CAS Number | 29644-79-9 |
|---|---|
| SMILES | C1=CC=C(C(=C1)C=NC2=CC=CC=C2[N+](=O)[O-])O |
| InChIKey | CQNTZLDBXMDWHG-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
(6E)-6-[(2-nitroanilino)methylidene]cyclohexa-2,4-dien-1-one (CAS 29644-79-9), with molecular formula C13H10N2O3 and molecular weight 242.06914 g/mol. IUPAC: 2-[(2-nitrophenyl)iminomethyl]phenol.