2-(9H-Carbazol-9-yl)ethyl methacrylate
2-carbazol-9-ylethyl 2-methylprop-2-enoate
Also Known As: 2-(9H-Carbazol-9-yl)ethyl methacrylate|9H-Carbazole-9-ethylmethacrylate|2-carbazol-9-ylethyl 2-methylprop-2-enoate|9H-Carbazole-9-ethanol methacrylate|2-Propenoic acid, 2-methyl-, 2-(9H-carbazol-9-yl)ethyl ester|2-(9H-carbazol-9-yl)ethyl 2-methylprop-2-enoate|2-(9H-Carbazol-9-yl)ethylmethacrylate|2-(9h-carbazole-9-yl) ethyl methacrylate|9-[2-(Methacryloyloxy)ethyl]-9H-carbazole|Methacrylic acid 2-(9H-carbazol-9-yl)ethyl ester|Methacrylic acid 2-(9H-carbazole 9-yl)ethyl ester|2-(CARBAZOL-9-YL)ETHYL 2-METHYLPROP-2-ENOATE|2-Methylpropenoic acid 2-(9H-carbazole-9-yl)ethyl ester|683-370-1
| Molecular Formula | C18H17NO2 |
|---|---|
| Molecular Weight | 279.12592 g/mol |
| LogP | 3.9138 |
| Topological Polar Surface Area | 31.23 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Exact Mass | 279.12592 |
| Monoisotopic Mass | 279.12592 |
| Heavy Atoms | 21 |
| Complexity | 776.22205 |
Chemical Identifiers
| CAS Number | 29692-07-7 |
|---|---|
| SMILES | CC(=C)C(=O)OCCN1C2=CC=CC=C2C3=CC=CC=C31 |
Product Overview
2-(9H-Carbazol-9-yl)ethyl methacrylate (CAS 29692-07-7), with molecular formula C18H17NO2 and molecular weight 279.12592 g/mol. IUPAC: 2-carbazol-9-ylethyl 2-methylprop-2-enoate.