2-(1-(4-Methoxyphenyl)ethylidene)malononitrile
2-[1-(4-methoxyphenyl)ethylidene]propanedinitrile
Also Known As: NCIOpen2_001646|2-(1-(4-Methoxyphenyl)ethylidene)malononitrile|2-[1-(4-methoxyphenyl)ethylidene]propanedinitrile|(1-(4-Methoxyphenyl)ethylidene)malononitrile|[1-(4-Methoxyphenyl)ethylidene]propanedinitrile|2-[1-(4-Methoxyphenyl)ethylidene]malononitrile|(4-Methoxy-alpha-methylbenzylidene)malononitrile|2-(alpha-Methyl-4-methoxybenzylidene)malononitrile|alpha-cyano-beta-(4-methoxyphenyl) crotononitrile|Propanedinitrile,2-[1-(4-methoxyphenyl)ethylidene]-
| Molecular Formula | C12H10N2O |
|---|---|
| Molecular Weight | 198.07932 g/mol |
| LogP | 2.1 |
| Topological Polar Surface Area | 56.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 198.07932 |
| Monoisotopic Mass | 198.07932 |
| Heavy Atoms | 15 |
| Complexity | 326.0 |
Chemical Identifiers
| CAS Number | 29914-79-2 |
|---|---|
| SMILES | CC(=C(C#N)C#N)C1=CC=C(C=C1)OC |
| InChIKey | FHABJCOKDOJSHP-UHFFFAOYSA-N |
Product Overview
2-(1-(4-Methoxyphenyl)ethylidene)malononitrile (CAS 29914-79-2), with molecular formula C12H10N2O and molecular weight 198.07932 g/mol. IUPAC: 2-[1-(4-methoxyphenyl)ethylidene]propanedinitrile.
2-(1-(4-Methoxyphenyl)ethylidene)malononitrile is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »