(5-chloro-1-methyl-3-phenyl-1H-pyrazol-4-yl)(2-thienyl)methanol
(5-chloro-1-methyl-3-phenylpyrazol-4-yl)-thiophen-2-ylmethanol
Also Known As: Bionet2_000815|KS-00001XKU|(5-chloro-1-methyl-3-phenyl-1H-pyrazol-4-yl)(thiophen-2-yl)methanol|5K-508S|(5-chloro-1-methyl-3-phenyl-1H-pyrazol-4-yl)(2-thienyl)methanol|(5-chloro-1-methyl-3-phenylpyrazol-4-yl)-thiophen-2-ylmethanol|(5-CHLORO-1-METHYL-3-PHENYL-1H-PYRAZOL4-YL)(THIOPHEN-2-YL)METHANOL|(5-chloro-1-methyl-3-phenyl-pyrazol-4-yl)-(2-thienyl)methanol|(5-chloro-1-methyl-3-phenylpyrazol-4-yl)(thiophen-2-yl)methanol
| Molecular Formula | C15H13ClN2OS |
|---|---|
| Molecular Weight | 304.0437 g/mol |
| LogP | 3.8837 |
| Topological Polar Surface Area | 38.05 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 304.0437 |
| Monoisotopic Mass | 304.0437 |
| Heavy Atoms | 20 |
| Complexity | 707.0661 |
Chemical Identifiers
| CAS Number | 29939-18-2 |
|---|---|
| SMILES | CN1C(=C(C(=N1)C2=CC=CC=C2)C(C3=CC=CS3)O)Cl |
Product Overview
(5-chloro-1-methyl-3-phenyl-1H-pyrazol-4-yl)(2-thienyl)methanol (CAS 29939-18-2), with molecular formula C15H13ClN2OS and molecular weight 304.0437 g/mol. IUPAC: (5-chloro-1-methyl-3-phenylpyrazol-4-yl)-thiophen-2-ylmethanol.
(5-chloro-1-methyl-3-phenyl-1H-pyrazol-4-yl)(2-thienyl)methanol is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »