5-fluoro-3-[1-(4-methoxyphenyl)-1H-tetraazol-5-yl]-1H-indole
5-fluoro-3-[1-(4-methoxyphenyl)tetrazol-5-yl]-1H-indole
Also Known As: Oprea1_260771|AG-401/37408032|5-fluoro-3-[1-(4-methoxyphenyl)-1H-tetraazol-5-yl]-1H-indole|5-fluoro-3-[1-(4-methoxyphenyl)tetrazol-5-yl]-1H-indole|5-fluoro-3-[1-(4-methoxyphenyl)-2H-tetrazol-5-ylidene]indole|(3E)-5-fluoro-3-[1-(4-methoxyphenyl)-2H-tetrazol-5-ylidene]indole|(3Z)-5-fluoro-3-[1-(4-methoxyphenyl)-2H-tetrazol-5-ylidene]indole|1-[5-(5-fluoroindol-3-yl)(1,2,3,4-tetraazolyl)]-4-methoxybenzene
| Molecular Formula | C16H12FN5O |
|---|---|
| Molecular Weight | 309.1026 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 68.6 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 309.1026 |
| Monoisotopic Mass | 309.1026 |
| Heavy Atoms | 23 |
| Complexity | 406.0 |
Chemical Identifiers
| CAS Number | 299462-83-2 |
|---|---|
| SMILES | COC1=CC=C(C=C1)N2C(=NN=N2)C3=CNC4=C3C=C(C=C4)F |
| InChIKey | IWVSFZWNUGITCA-UHFFFAOYSA-N |
Product Overview
5-fluoro-3-[1-(4-methoxyphenyl)-1H-tetraazol-5-yl]-1H-indole (CAS 299462-83-2), with molecular formula C16H12FN5O and molecular weight 309.1026 g/mol. IUPAC: 5-fluoro-3-[1-(4-methoxyphenyl)tetrazol-5-yl]-1H-indole.
5-fluoro-3-[1-(4-methoxyphenyl)-1H-tetraazol-5-yl]-1H-indole is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »