3-Benzyl-5-((5-(3-chloro-PH)-2-furyl)methylene)-2-thioxo-1,3-thiazolidin-4-one
(5Z)-3-benzyl-5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one
Also Known As: 3-Benzyl-5-((5-(3-chlorophenyl)furan-2-yl)methylene)-2-thioxothiazolidin-4-one|3-BENZYL-5-((5-(3-CHLORO-PH)-2-FURYL)METHYLENE)-2-THIOXO-1,3-THIAZOLIDIN-4-ONE|(5E)-3-BENZYL-5-{[5-(3-CHLOROPHENYL)FURAN-2-YL]METHYLIDENE}-2-SULFANYLIDENE-1,3-THIAZOLIDIN-4-ONE|(5Z)-3-benzyl-5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one|632-149-8
| Molecular Formula | C21H14ClNO2S2 |
|---|---|
| Molecular Weight | 411.01544 g/mol |
| LogP | 6.0014 |
| Topological Polar Surface Area | 33.45 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 411.01544 |
| Monoisotopic Mass | 411.01544 |
| Heavy Atoms | 27 |
| Complexity | 1043.0999 |
Chemical Identifiers
| CAS Number | 299907-87-2 |
|---|---|
| SMILES | C1=CC=C(C=C1)CN2C(=O)/C(=C/C3=CC=C(O3)C4=CC(=CC=C4)Cl)/SC2=S |
Product Overview
3-Benzyl-5-((5-(3-chloro-PH)-2-furyl)methylene)-2-thioxo-1,3-thiazolidin-4-one (CAS 299907-87-2), with molecular formula C21H14ClNO2S2 and molecular weight 411.01544 g/mol. IUPAC: (5Z)-3-benzyl-5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.