AC1ME3OV
cyclohexyl 2-methyl-5-oxo-4-[2-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate
Also Known As: BAS 00411020|AG-690/10380051|cyclohexyl 2-methyl-5-oxo-4-[2-(trifluoromethyl)phenyl]-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate|SR-01000435916-1|cyclohexyl 2-methyl-5-oxo-4-[2-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate|cyclohexyl 2-methyl-5-oxo-4-(2-(trifluoromethyl)phenyl)-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate|cyclohexyl 2-methyl-5-oxo-4-[2-(trifluoromethyl)phenyl]-1,4,6,7,8-pentahydroqu inoline-3-carboxylate
| Molecular Formula | C24H26F3NO3 |
|---|---|
| Molecular Weight | 433.1865 g/mol |
| LogP | 5.5492 |
| Topological Polar Surface Area | 55.4 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 433.1865 |
| Monoisotopic Mass | 433.1865 |
| Heavy Atoms | 31 |
| Complexity | 955.06134 |
Chemical Identifiers
| CAS Number | 299947-75-4 |
|---|---|
| SMILES | CC1=C(C(C2=C(N1)CCCC2=O)C3=CC=CC=C3C(F)(F)F)C(=O)OC4CCCCC4 |
Product Overview
AC1ME3OV (CAS 299947-75-4), with molecular formula C24H26F3NO3 and molecular weight 433.1865 g/mol. IUPAC: cyclohexyl 2-methyl-5-oxo-4-[2-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.