2-chloro-1-(5-methoxy-1H-indol-3-yl)ethanone
2-chloro-1-(5-methoxy-1H-indol-3-yl)ethanone
Also Known As: 2-chloro-1-(5-methoxy-1H-indol-3-yl)ethanone|2-Chloro-1-(5-methoxy-1H-indol-3-yl)-ethanone|2-chloro-1-(5-methoxy-1H-indol-3-yl)ethan-1-one|3-chloroacetyl-5-methoxy-indole|BAS 10142255|5-Methoxy-3-(chloroacetyl)-1H-indole|Ethanone, 2-chloro-1-(5-methoxy-1H-indol-3-yl)-|BB 0260452|J1.891.105A|2-chloro-1-(5-methoxyindol-3-yl)ethan-1-one|SR-01000368668-1
| Molecular Formula | C11H10ClNO2 |
|---|---|
| Molecular Weight | 223.04001 g/mol |
| LogP | 2.598 |
| Topological Polar Surface Area | 42.09 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 223.04001 |
| Monoisotopic Mass | 223.04001 |
| Heavy Atoms | 15 |
| Complexity | 504.25726 |
Chemical Identifiers
| CAS Number | 30030-91-2 |
|---|---|
| SMILES | COC1=CC2=C(C=C1)NC=C2C(=O)CCl |
Product Overview
2-chloro-1-(5-methoxy-1H-indol-3-yl)ethanone (CAS 30030-91-2), with molecular formula C11H10ClNO2 and molecular weight 223.04001 g/mol. IUPAC: 2-chloro-1-(5-methoxy-1H-indol-3-yl)ethanone.
2-chloro-1-(5-methoxy-1H-indol-3-yl)ethanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »