Tert-butyl 2-(4-aminophenyl)acetate
tert-butyl 2-(4-aminophenyl)acetate
Also Known As: tert-butyl 2-(4-aminophenyl)acetate|tert-Butyl-4-aminophenylacetate|tert-Butyl 4-aminophenylacetate|tert.butyl 4-aminophenylacetate|KS-00000GPU|4-Amino-benzeneacetic acid tert-butyl ester|tert-butyl (4-aminophenyl)acetate|9036AA|2-(4-aminophenyl)-3,3-dimethylbutanoate|4-aminophenylacetic acid t-butyl ester|PS-3064|4-Aminophenylacetic acid tert-butyl ester|Benzeneacetic acid, 4-amino-, 1,1-dimethylethyl ester|2-(4-Aminophenyl)acetic acid tert-butyl ester|(4-amino)-phenyl acetic acid t-butyl ester|4-Aminobenzene 1-acetic acid tert-butyl ester|J1.953.326C|(4-amino-phenyl)-acetic acid tert-butyl ester|C-6098|2-(3-methoxyphenylcarbamoyl)-cyclohexanecarboxylic acid
| Molecular Formula | C12H17NO2 |
|---|---|
| Molecular Weight | 207.12593 g/mol |
| LogP | 2.153 |
| Topological Polar Surface Area | 52.32 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 207.12593 |
| Monoisotopic Mass | 207.12593 |
| Heavy Atoms | 15 |
| Complexity | 335.63492 |
Chemical Identifiers
| CAS Number | 301352-85-2 |
|---|---|
| SMILES | CC(C)(C)OC(=O)CC1=CC=C(C=C1)N |
Product Overview
Tert-butyl 2-(4-aminophenyl)acetate (CAS 301352-85-2), with molecular formula C12H17NO2 and molecular weight 207.12593 g/mol. IUPAC: tert-butyl 2-(4-aminophenyl)acetate.