(5-Chloro-thiophen-2-yl)-(3-trichloromethyl-oxiranyl)-methanone
(5-chlorothiophen-2-yl)-[3-(trichloromethyl)oxiran-2-yl]methanone
Also Known As: BAS 00126697|(5-Chloro-thiophen-2-yl)-(3-trichloromethyl-oxiranyl)-methanone|(5-Chloro-2-thienyl)[3-(trichloromethyl)-2-oxiranyl]methanone #|(5-chlorothiophen-2-yl)(3-(trichloromethyl)oxiran-2-yl)methanone|(5-chlorothiophen-2-yl)-[3-(trichloromethyl)oxiran-2-yl]methanone|(5-chlorothiophen-2-yl)[3-(trichloromethyl)oxiran-2-yl]methanone
| Molecular Formula | C8H4Cl4O2S |
|---|---|
| Molecular Weight | 303.86862 g/mol |
| LogP | 4.2 |
| Topological Polar Surface Area | 57.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 303.86862 |
| Monoisotopic Mass | 303.86862 |
| Heavy Atoms | 15 |
| Complexity | 280.0 |
Chemical Identifiers
| CAS Number | 301655-28-7 |
|---|---|
| SMILES | C1=C(SC(=C1)Cl)C(=O)C2C(O2)C(Cl)(Cl)Cl |
| InChIKey | DOYFRJYTPOFEQR-UHFFFAOYSA-N |
Product Overview
(5-Chloro-thiophen-2-yl)-(3-trichloromethyl-oxiranyl)-methanone (CAS 301655-28-7), with molecular formula C8H4Cl4O2S and molecular weight 303.86862 g/mol. IUPAC: (5-chlorothiophen-2-yl)-[3-(trichloromethyl)oxiran-2-yl]methanone.
(5-Chloro-thiophen-2-yl)-(3-trichloromethyl-oxiranyl)-methanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »