AC1MERR4
6-amino-3-tert-butyl-4-(3,4,5-trimethoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile
Also Known As: BAS 07094059|6-amino-3-(tert-butyl)-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile|AB00092699-01|AK-777/37037111|AM-807/13104096|6-amino-3-tert-butyl-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile|6-amino-3-tert-butyl-4-(3,4,5-trimethoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile|6-amino-3-(tert-butyl)-4-(3,4,5-trimethoxyphenyl)-4H-pyrano[3,2-d]pyrazole-5-c arbonitrile
| Molecular Formula | C20H24N4O4 |
|---|---|
| Molecular Weight | 384.17975 g/mol |
| LogP | 2.95118 |
| Topological Polar Surface Area | 115.41 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Exact Mass | 384.17975 |
| Monoisotopic Mass | 384.17975 |
| Heavy Atoms | 28 |
| Complexity | 954.0626 |
Chemical Identifiers
| CAS Number | 304875-69-2 |
|---|---|
| SMILES | CC(C)(C)C1=C2C(C(=C(OC2=NN1)N)C#N)C3=CC(=C(C(=C3)OC)OC)OC |
Product Overview
AC1MERR4 (CAS 304875-69-2), with molecular formula C20H24N4O4 and molecular weight 384.17975 g/mol. IUPAC: 6-amino-3-tert-butyl-4-(3,4,5-trimethoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile.