5-(2-Methyl-propane-2-sulfonyl)-thiophene-2-carboxylic acid
5-tert-butylsulfonylthiophene-2-carboxylic acid
Also Known As: ChemDiv3_000972|5-(2-Methyl-propane-2-sulfonyl)-thiophene-2-carboxylic acid|CBDivE_008902|5-(tert-butylsulfonyl)thiophene-2-carboxylic acid|9669AD|BAS 00529313|IDI1_019938|5-tert-butylsulfonylthiophene-2-carboxylic acid|5-[(tert-butyl)sulfonyl]thiophene-2-carboxylic acid|5-(tert-butylsulfonyl)thiophene-2-carboxylicacid|AB00073663-01|5-(2-methylpropane-2-sulfonyl)thiophene-2-carboxylic acid|BRD-K88792929-001-02-6
| Molecular Formula | C9H12O4S2 |
|---|---|
| Molecular Weight | 248.0177 g/mol |
| LogP | 2.0 |
| Topological Polar Surface Area | 108.0 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 248.0177 |
| Monoisotopic Mass | 248.0177 |
| Heavy Atoms | 15 |
| Complexity | 347.0 |
Chemical Identifiers
| CAS Number | 306293-86-7 |
|---|---|
| SMILES | CC(C)(C)S(=O)(=O)C1=CC=C(S1)C(=O)O |
| InChIKey | ICNMIDYXOGQVOC-UHFFFAOYSA-N |
Product Overview
5-(2-Methyl-propane-2-sulfonyl)-thiophene-2-carboxylic acid (CAS 306293-86-7), with molecular formula C9H12O4S2 and molecular weight 248.0177 g/mol. IUPAC: 5-tert-butylsulfonylthiophene-2-carboxylic acid.
5-(2-Methyl-propane-2-sulfonyl)-thiophene-2-carboxylic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »