(2-Fluoro-5-nitrophenyl)[4-(methylsulfanyl)benzylidene]amine
N-(2-fluoro-5-nitrophenyl)-1-(4-methylsulfanylphenyl)methanimine
Also Known As: KS-000049ZP|BAS 00675418|(2-fluoro-5-nitrophenyl)[4-(methylsulfanyl)benzylidene]amine|AG-690/11962750|N-(2-fluoro-5-nitrophenyl)-1-(4-methylsulfanylphenyl)methanimine|2-fluoro-N-[4-(methylsulfanyl)benzylidene]-5-nitroaniline|(2-Fluoro-5-nitro-phenyl)-(4-methylsulfanyl-benzylidene)-amine|1-[(1E)-2-(2-fluoro-5-nitrophenyl)-2-azavinyl]-4-methylthiobenzene|2-fluoro-N-{(E)-[4-(methylsulfanyl)phenyl]methylidene}-5-nitroaniline
| Molecular Formula | C14H11FN2O2S |
|---|---|
| Molecular Weight | 290.05252 g/mol |
| LogP | 3.7 |
| Topological Polar Surface Area | 83.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 290.05252 |
| Monoisotopic Mass | 290.05252 |
| Heavy Atoms | 20 |
| Complexity | 354.0 |
Chemical Identifiers
| CAS Number | 306325-51-9 |
|---|---|
| SMILES | CSC1=CC=C(C=C1)C=NC2=C(C=CC(=C2)[N+](=O)[O-])F |
| InChIKey | QDJMRQMURQZSTN-UHFFFAOYSA-N |
Product Overview
(2-Fluoro-5-nitrophenyl)[4-(methylsulfanyl)benzylidene]amine (CAS 306325-51-9), with molecular formula C14H11FN2O2S and molecular weight 290.05252 g/mol. IUPAC: N-(2-fluoro-5-nitrophenyl)-1-(4-methylsulfanylphenyl)methanimine.
(2-Fluoro-5-nitrophenyl)[4-(methylsulfanyl)benzylidene]amine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »