3-[(4-Ethylnaphthyl)nitromethylene]isobenzofuran-1-one
(3Z)-3-[(4-ethylnaphthalen-1-yl)-nitromethylidene]-2-benzofuran-1-one
Also Known As: Oprea1_000681|BAS 00163783|3-[(4-ethylnaphthyl)nitromethylene]isobenzofuran-1-one|(3Z)-3-[(4-ethylnaphthalen-1-yl)-nitromethylidene]-2-benzofuran-1-one|(Z)-3-((4-ethylnaphthalen-1-yl)(nitro)methylene)isobenzofuran-1(3H)-one|3-[(4-Ethyl-naphthalen-1-yl)-nitro-methylene]-3H-isobenzofuran-1-one|(3Z)-3-[(4-ethylnaphthalen-1-yl)(nitro)methylidene]-2-benzofuran-1(3H)-one
| Molecular Formula | C21H15NO4 |
|---|---|
| Molecular Weight | 345.1001 g/mol |
| LogP | 4.6751 |
| Topological Polar Surface Area | 69.44 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 345.1001 |
| Monoisotopic Mass | 345.1001 |
| Heavy Atoms | 26 |
| Complexity | 1098.1163 |
Chemical Identifiers
| CAS Number | 30645-75-1 |
|---|---|
| SMILES | CCC1=CC=C(C2=CC=CC=C12)/C(=C/3\C4=CC=CC=C4C(=O)O3)/[N+](=O)[O-] |
Product Overview
3-[(4-Ethylnaphthyl)nitromethylene]isobenzofuran-1-one (CAS 30645-75-1), with molecular formula C21H15NO4 and molecular weight 345.1001 g/mol. IUPAC: (3Z)-3-[(4-ethylnaphthalen-1-yl)-nitromethylidene]-2-benzofuran-1-one.
3-[(4-Ethylnaphthyl)nitromethylene]isobenzofuran-1-one is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »