4,5,6,7-tetrachloro-2,3-dihydro-1H-indene-1,3-dione
4,5,6,7-tetrachloroindene-1,3-dione
Also Known As: TCID|4,5,6,7-Tetrachloro-1H-indene-1,3(2H)-dione|UCH-L3 Inhibitor|4,5,6,7-Tetrachloroindan-1,3-dione|4,5,6,7-tetrachloroindene-1,3-dione|Maybridge1_006552|COMPOUND 6|4,5,6,7-Tetrachloroindane-1,3-dione|1,3-INDANDIONE|UCH-L3|GTPL8660|HMS560B18|AMY2467|Ubiquitin Thiolesterase L3 Inhibitor|1H-Indene-1,3(2H)-dione, 4,5,6,7-tetrachloro-|compound 6 [PMID: 17948018]|TCID, >=98% (HPLC)|IN1020|RW3397|s7140|4,5,6,7-tetrachloro-2H-indene-1,3-dione|QC-2393|Ubiquitin C-Terminal Esterase L3 Inhibitor|4,5,6,7-Tetrachloro-1,3-indanedione|Ubiquitin C-Terminal Hydrolase L3 Inhibitor|NCGC00386265-04
| Molecular Formula | C9H2Cl4O2 |
|---|---|
| Molecular Weight | 281.8809 g/mol |
| LogP | 4.0693 |
| Topological Polar Surface Area | 34.14 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 0 |
| Exact Mass | 281.8809 |
| Monoisotopic Mass | 283.87793 |
| Heavy Atoms | 15 |
| Complexity | 462.56918 |
Chemical Identifiers
| CAS Number | 30675-13-9 |
|---|---|
| SMILES | C1C(=O)C2=C(C1=O)C(=C(C(=C2Cl)Cl)Cl)Cl |
Product Overview
4,5,6,7-tetrachloro-2,3-dihydro-1H-indene-1,3-dione (CAS 30675-13-9), with molecular formula C9H2Cl4O2 and molecular weight 281.8809 g/mol. IUPAC: 4,5,6,7-tetrachloroindene-1,3-dione.