![N-{4-[(4-chlorophenyl)sulfanyl]-3-cyanophenyl}-4-fluorobenzenecarboxamide structure](/static/products/3069/306980-47-2.webp)
N-{4-[(4-chlorophenyl)sulfanyl]-3-cyanophenyl}-4-fluorobenzenecarboxamide
N-[4-(4-chlorophenyl)sulfanyl-3-cyanophenyl]-4-fluorobenzamide
Also Known As: Bionet1_002245|Oprea1_105105|HMS574M07|KS-00001SSA|N-{4-[(4-chlorophenyl)sulfanyl]-3-cyanophenyl}-4-fluorobenzenecarboxamide|12K-521S|N-{4-[(4-chlorophenyl)sulfanyl]-3-cyanophenyl}-4-fluorobenzamide|N-[4-(4-chlorophenyl)sulfanyl-3-cyanophenyl]-4-fluorobenzamide|N-[4-(4-chlorophenyl)sulfanyl-3-cyano-phenyl]-4-fluoro-benzamide
| Molecular Formula | C20H12ClFN2OS |
|---|---|
| Molecular Weight | 382.0343 g/mol |
| LogP | 5.75428 |
| Topological Polar Surface Area | 52.89 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 382.0343 |
| Monoisotopic Mass | 382.0343 |
| Heavy Atoms | 26 |
| Complexity | 982.1882 |
Chemical Identifiers
| CAS Number | 306980-47-2 |
|---|---|
| SMILES | C1=CC(=CC=C1C(=O)NC2=CC(=C(C=C2)SC3=CC=C(C=C3)Cl)C#N)F |
Product Overview
N-{4-[(4-chlorophenyl)sulfanyl]-3-cyanophenyl}-4-fluorobenzenecarboxamide (CAS 306980-47-2), with molecular formula C20H12ClFN2OS and molecular weight 382.0343 g/mol. IUPAC: N-[4-(4-chlorophenyl)sulfanyl-3-cyanophenyl]-4-fluorobenzamide.
N-{4-[(4-chlorophenyl)sulfanyl]-3-cyanophenyl}-4-fluorobenzenecarboxamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »