4-(4-Chlorobenzyl)-N-(4-chlorobenzylidene)-1-piperazinamine
(E)-1-(4-chlorophenyl)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methanimine
Also Known As: (E)-4-(4-chlorobenzyl)-N-(4-chlorobenzylidene)piperazin-1-amine|1-(4-chlorophenyl)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methanimine|4-(4-CHLOROBENZYL)-N-(4-CHLOROBENZYLIDENE)-1-PIPERAZINAMINE|4-(4-chlorobenzyl)-N-[(E)-(4-chlorophenyl)methylidene]piperazin-1-amine|(E)-1-(4-chlorophenyl)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methanimine|(E)-1-(4-CHLOROPHENYL)-N-{4-[(4-CHLOROPHENYL)METHYL]PIPERAZIN-1-YL}METHANIMINE
| Molecular Formula | C18H19Cl2N3 |
|---|---|
| Molecular Weight | 347.0956 g/mol |
| LogP | 4.1451 |
| Topological Polar Surface Area | 18.84 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 347.0956 |
| Monoisotopic Mass | 347.0956 |
| Heavy Atoms | 23 |
| Complexity | 644.97186 |
Chemical Identifiers
| CAS Number | 306989-66-2 |
|---|---|
| SMILES | C1CN(CCN1CC2=CC=C(C=C2)Cl)/N=C/C3=CC=C(C=C3)Cl |
Product Overview
4-(4-Chlorobenzyl)-N-(4-chlorobenzylidene)-1-piperazinamine (CAS 306989-66-2), with molecular formula C18H19Cl2N3 and molecular weight 347.0956 g/mol. IUPAC: (E)-1-(4-chlorophenyl)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methanimine.
4-(4-Chlorobenzyl)-N-(4-chlorobenzylidene)-1-piperazinamine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »