Vinyl perfluorooctanoate
ethenyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate
Also Known As: Vinyl perfluorooctanoate|Ethenyl perfluorooctanoate|Ethenyl pentadecafluorooctanoate|Ethenyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate|Pentadecafluorooctanoic acid vinyl ester|J1.335.014K|Octanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-, ethenyl ester|vinyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate|2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoic acid ethenyl ester|ethenyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecakis(fluoranyl)octanoate|Octanoic acid,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-, ethenyl ester
| Molecular Formula | C10H3F15O2 |
|---|---|
| Molecular Weight | 439.98935 g/mol |
| LogP | 5.0472 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Exact Mass | 439.98935 |
| Monoisotopic Mass | 439.98935 |
| Heavy Atoms | 27 |
| Complexity | 587.89526 |
Chemical Identifiers
| CAS Number | 307-93-7 |
|---|---|
| SMILES | C=COC(=O)C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Product Overview
Vinyl perfluorooctanoate (CAS 307-93-7), with molecular formula C10H3F15O2 and molecular weight 439.98935 g/mol. IUPAC: ethenyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate.