1,1'-Biphenyl, 2,2',5,5'-tetramethyl-
2-(2,5-dimethylphenyl)-1,4-dimethylbenzene
Also Known As: 2,2',5,5'-tetramethylbiphenyl|1,1'-Biphenyl, 2,2',5,5'-tetramethyl-|2,2',5,5'-Tetramethyl-1,1'-biphenyl|ACMC-20aokf|2-(2,5-dimethylphenyl)-1,4-dimethylbenzene|6-Methoxy-2-naphthaldehyde|22'55'-Tetramethylbiphenyl|Biphenyl-, 2,2',5,5'-tetramethyl-|2,5,2',5'-tetramethylbiphenyl|2,2 ,5,5 -Tetramethylbiphenyl|1,1'-Biphenyl,2,2',5,5'-tetramethyl-|2,2',5,5'-Tetramethyl-1,1'-biphenyl #|1,1-BIPHENYL,2,2,5,5-TETRAMETHYL-|2-(2,5-dimethylphenyl)-1,4-dimethyl-benzene|2,2',5,5'-TETRAMETHYLBIPHENYL, 98%|2,2 ,5,5 -Tetramethyl-1,1 -biphenyl|2,2',5,5'-TETRAMETHYLBIPHENYL|I14-63305|2 pound not2' pound not5 pound not5'-Tetramethylbiphenyl
| Molecular Formula | C16H18 |
|---|---|
| Molecular Weight | 210.14085 g/mol |
| LogP | 5.0 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 1 |
| Exact Mass | 210.14085 |
| Monoisotopic Mass | 210.14085 |
| Heavy Atoms | 16 |
| Complexity | 196.0 |
Chemical Identifiers
| CAS Number | 3075-84-1 |
|---|---|
| SMILES | CC1=CC(=C(C=C1)C)C2=C(C=CC(=C2)C)C |
| InChIKey | ZHTROMYSDSTCCE-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1,1'-Biphenyl, 2,2',5,5'-tetramethyl- (CAS 3075-84-1), with molecular formula C16H18 and molecular weight 210.14085 g/mol. IUPAC: 2-(2,5-dimethylphenyl)-1,4-dimethylbenzene.