Cinnamanilide
(E)-N,3-diphenylprop-2-enamide
Also Known As: Cinnamanilide|N,3-diphenylacrylamide|N-Phenylcinnamamide|(E)-N-Phenylcinnamamide|diphenylacrylamide|2-Propenamide, N,3-diphenyl-|(E)-N,3-diphenylprop-2-enamide|N,3-Diphenyl-2-propenamide|(2E)-N,3-diphenylprop-2-enamide|(2e)-n,3-diphenylacrylamide|N-Phenylbenzeneacrylamide|N,3-diphenylprop-2-enamide|N-Phenyl-trans-cinnamamide|2-Propenamide,3-diphenyl-|(E)-N,3-Diphenylacrylamide|AURORA KA-3355|(E)-N,3-Diphenylpropenamide|(E)-N,3-diphenyl-acrylamide|EINECS 221-289-1|N,3-Di(Phenyl)Prop-2-Enamide|N-(3-DIPHENYLACRYLAMIDE)|(E)-N-Phenyl-3-phenylacrylamide|KST-1A3654|AI3-03766|8533AD
| Molecular Formula | C15H13NO |
|---|---|
| Molecular Weight | 223.09972 g/mol |
| LogP | 3.6 |
| Topological Polar Surface Area | 29.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Exact Mass | 223.09972 |
| Monoisotopic Mass | 223.09972 |
| Heavy Atoms | 17 |
| Complexity | 260.0 |
Chemical Identifiers
| CAS Number | 30799-11-2 |
|---|---|
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)NC2=CC=CC=C2 |
| InChIKey | FIIZQHKGJMRJIL-VAWYXSNFSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Cinnamanilide (CAS 30799-11-2), with molecular formula C15H13NO and molecular weight 223.09972 g/mol. IUPAC: (E)-N,3-diphenylprop-2-enamide.