AC1LE6K6
2-(2-methylprop-2-enylsulfanyl)-6-phenyl-4-thiophen-2-ylpyridine-3-carbonitrile
Also Known As: Oprea1_522079|Oprea1_552533|KS-00004BY7|AN-329/14225007|SR-01000493597-1|2-((2-methylprop-2-enyl)sulfanyl)-6-phenyl-4-thiophen-2-ylpyridine-3-carbonitrile|2-[(2-methylprop-2-en-1-yl)sulfanyl]-6-phenyl-4-(thiophen-2-yl)pyridine-3-carbonitrile|2-(2-methylprop-2-enylsulfanyl)-6-phenyl-4-thiophen-2-ylpyridine-3-carbonitrile|2-(2-methylprop-2-enylthio)-6-phenyl-4-(2-thienyl)pyridine-3-carbonitrile|2-[(2-methyl-2-propen-1-yl)sulfanyl]-6-phenyl-4-(2-thienyl)nicotinonitrile
| Molecular Formula | C20H16N2S2 |
|---|---|
| Molecular Weight | 348.0755 g/mol |
| LogP | 5.7 |
| Topological Polar Surface Area | 90.2 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 348.0755 |
| Monoisotopic Mass | 348.0755 |
| Heavy Atoms | 24 |
| Complexity | 477.0 |
Chemical Identifiers
| CAS Number | 308293-69-8 |
|---|---|
| SMILES | CC(=C)CSC1=C(C(=CC(=N1)C2=CC=CC=C2)C3=CC=CS3)C#N |
| InChIKey | HGOOQPFGDIVMOP-UHFFFAOYSA-N |
Product Overview
AC1LE6K6 (CAS 308293-69-8), with molecular formula C20H16N2S2 and molecular weight 348.0755 g/mol. IUPAC: 2-(2-methylprop-2-enylsulfanyl)-6-phenyl-4-thiophen-2-ylpyridine-3-carbonitrile.
AC1LE6K6 is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »