(3,5-dimethyl-4-(p-tolylthio)-1H-pyrazol-1-yl)(furan-2-yl)methanone
[3,5-dimethyl-4-(4-methylphenyl)sulfanylpyrazol-1-yl]-(furan-2-yl)methanone
Also Known As: CBMicro_031809|BIM-0031684.P001|F0755-0036|1-(furan-2-carbonyl)-3,5-dimethyl-4-[(4-methylphenyl)sulfanyl]-1H-pyrazole|SR-01000443889-1|(3,5-dimethyl-4-(p-tolylthio)-1H-pyrazol-1-yl)(furan-2-yl)methanone|[3,5-dimethyl-4-(4-methylphenyl)sulfanylpyrazol-1-yl]-(furan-2-yl)methanone|[3,5-dimethyl-4-(p-tolylthio)-1-pyrazolyl](2-furyl)methanone|1-(2-furoyl)-3,5-dimethyl-1H-pyrazol-4-yl 4-methylphenyl sulfide
| Molecular Formula | C17H16N2O2S |
|---|---|
| Molecular Weight | 312.09326 g/mol |
| LogP | 4.4 |
| Topological Polar Surface Area | 73.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 312.09326 |
| Monoisotopic Mass | 312.09326 |
| Heavy Atoms | 22 |
| Complexity | 398.0 |
Chemical Identifiers
| CAS Number | 308294-36-2 |
|---|---|
| SMILES | CC1=CC=C(C=C1)SC2=C(N(N=C2C)C(=O)C3=CC=CO3)C |
| InChIKey | WZTILVXREWVPRS-UHFFFAOYSA-N |
Product Overview
(3,5-dimethyl-4-(p-tolylthio)-1H-pyrazol-1-yl)(furan-2-yl)methanone (CAS 308294-36-2), with molecular formula C17H16N2O2S and molecular weight 312.09326 g/mol. IUPAC: [3,5-dimethyl-4-(4-methylphenyl)sulfanylpyrazol-1-yl]-(furan-2-yl)methanone.
(3,5-dimethyl-4-(p-tolylthio)-1H-pyrazol-1-yl)(furan-2-yl)methanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »