(5-Methoxy-2-methyl-1-benzofuran-3-yl)(4-nitrophenyl)methanone
(5-methoxy-2-methyl-1-benzofuran-3-yl)-(4-nitrophenyl)methanone
Also Known As: Oprea1_545630|2-methyl-3-(p-nitrobenzoyl)-5-methoxybenzofuran|(5-methoxy-2-methylbenzofuran-3-yl)(4-nitrophenyl)methanone|(5-methoxy-2-methyl-1-benzofuran-3-yl)(4-nitrophenyl)methanone|(5-methoxy-2-methyl-1-benzofuran-3-yl)-(4-nitrophenyl)methanone|(5-Methoxy-2-methyl-benzofuran-3-yl)-(4-nitro-phenyl)-methanone
| Molecular Formula | C17H13NO5 |
|---|---|
| Molecular Weight | 311.07938 g/mol |
| LogP | 3.88902 |
| Topological Polar Surface Area | 82.58 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 311.07938 |
| Monoisotopic Mass | 311.07938 |
| Heavy Atoms | 23 |
| Complexity | 908.6285 |
Chemical Identifiers
| CAS Number | 308796-93-2 |
|---|---|
| SMILES | CC1=C(C2=C(O1)C=CC(=C2)OC)C(=O)C3=CC=C(C=C3)[N+](=O)[O-] |
Product Overview
(5-Methoxy-2-methyl-1-benzofuran-3-yl)(4-nitrophenyl)methanone (CAS 308796-93-2), with molecular formula C17H13NO5 and molecular weight 311.07938 g/mol. IUPAC: (5-methoxy-2-methyl-1-benzofuran-3-yl)-(4-nitrophenyl)methanone.
(5-Methoxy-2-methyl-1-benzofuran-3-yl)(4-nitrophenyl)methanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »