AC1LCR0R
methyl 6-amino-4-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate
Also Known As: NCGC00036059-02|BAS 07416648|AM-807/12227004|methyl 6-amino-4-(5-chloro-3-methyl-1-phenyl-1H-pyrazol-4-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate|methyl 6-amino-4-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate|6-Amino-4-(5-chloro-3-methyl-1-phenyl-1H-pyrazol-4-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylic acid methyl ester|methyl 6-amino-4-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-5-cyano-2-methyl-4H- pyran-3-carboxylate
| Molecular Formula | C19H17ClN4O3 |
|---|---|
| Molecular Weight | 384.0989 g/mol |
| LogP | 3.4 |
| Topological Polar Surface Area | 103.0 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Exact Mass | 384.0989 |
| Monoisotopic Mass | 384.0989 |
| Heavy Atoms | 27 |
| Complexity | 720.0 |
Chemical Identifiers
| CAS Number | 311809-77-5 |
|---|---|
| SMILES | CC1=C(C(C(=C(O1)N)C#N)C2=C(N(N=C2C)C3=CC=CC=C3)Cl)C(=O)OC |
| InChIKey | ZVSXTJKDDNGMDI-UHFFFAOYSA-N |
Product Overview
AC1LCR0R (CAS 311809-77-5), with molecular formula C19H17ClN4O3 and molecular weight 384.0989 g/mol. IUPAC: methyl 6-amino-4-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate.