N-(4-Chlorophenyl)-4-fluorobenzenesulfonamide
N-(4-chlorophenyl)-4-fluorobenzenesulfonamide
Also Known As: N-(4-Chlorophenyl)-4-fluorobenzenesulfonamide|4-fluoro-N-(4-chlorophenyl)benzenesulfonamide|BAS 01358635|Benzenesulfonamide, N-(4-chlorophenyl)-4-fluoro-|N-(4-chlorophenyl)-4-fluorobenzene-1-sulfonamide|Benzenesulfonanilide, 4'-chloro-4-fluoro-|(4-chlorophenyl)[(4-fluorophenyl)sulfonyl]amine|AB00025931-01|AB00025931-02|N-(4-Chloro-phenyl)-4-fluoro-benzenesulfonamide|N-(4-Chlorophenyl)-4-fluorobenzenesulfonamide #
| Molecular Formula | C12H9ClFNO2S |
|---|---|
| Molecular Weight | 285.00266 g/mol |
| LogP | 3.5 |
| Topological Polar Surface Area | 54.6 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 285.00266 |
| Monoisotopic Mass | 285.00266 |
| Heavy Atoms | 18 |
| Complexity | 355.0 |
Chemical Identifiers
| CAS Number | 312-57-2 |
|---|---|
| SMILES | C1=CC(=CC=C1NS(=O)(=O)C2=CC=C(C=C2)F)Cl |
| InChIKey | DFVHRDLVQACADE-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
N-(4-Chlorophenyl)-4-fluorobenzenesulfonamide (CAS 312-57-2), with molecular formula C12H9ClFNO2S and molecular weight 285.00266 g/mol. IUPAC: N-(4-chlorophenyl)-4-fluorobenzenesulfonamide.