methyl 2,5-dimethyl-4-(4-methylphenyl)-1H-pyrrole-3-carboxylate
methyl 2,5-dimethyl-4-(4-methylphenyl)-1H-pyrrole-3-carboxylate
Also Known As: methyl 2,5-dimethyl-4-(4-methylphenyl)-1H-pyrrole-3-carboxylate|J3.037.484C|AG-205/09891004|SR-01000513326-1|1H-Pyrrole-3-carboxylicacid,2,5-dimethyl-4- -,methylester|A1116/0052429|1H-Pyrrole-3-carboxylicacid,2,5-dimethyl-4-(4-methylphenyl)-,methylester(9ci)|2,5-Dimethyl-4-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid methyl ester|1H-Pyrrole-3-carboxylic acid, 2,5-dimethyl-4-(4-methylphenyl)-, methyl ester (9CI)
| Molecular Formula | C15H17NO2 |
|---|---|
| Molecular Weight | 243.12593 g/mol |
| LogP | 3.4 |
| Topological Polar Surface Area | 42.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 243.12593 |
| Monoisotopic Mass | 243.12593 |
| Heavy Atoms | 18 |
| Complexity | 297.0 |
Chemical Identifiers
| CAS Number | 312271-07-1 |
|---|---|
| SMILES | CC1=CC=C(C=C1)C2=C(NC(=C2C(=O)OC)C)C |
| InChIKey | YPFVCLDHXMFUMX-UHFFFAOYSA-N |
Product Overview
methyl 2,5-dimethyl-4-(4-methylphenyl)-1H-pyrrole-3-carboxylate (CAS 312271-07-1), with molecular formula C15H17NO2 and molecular weight 243.12593 g/mol. IUPAC: methyl 2,5-dimethyl-4-(4-methylphenyl)-1H-pyrrole-3-carboxylate.
methyl 2,5-dimethyl-4-(4-methylphenyl)-1H-pyrrole-3-carboxylate is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »