3-Chloro-N-(2-methoxyphenyl)-6-methylbenzo[b]thiophene-2-carboxamide
3-chloro-N-(2-methoxyphenyl)-6-methyl-1-benzothiophene-2-carboxamide
Also Known As: 3-Chloro-N-(2-methoxyphenyl)-6-methylbenzo[b]thiophene-2-carboxamide|BAS 01516949|3-chloro-N-(2-methoxyphenyl)-6-methyl-1-benzothiophene-2-carboxamide|AG-690/40696507|SR-01000438377-1|3-Chloro-6-methyl-benzo[b]thiophene-2-carboxylic acid (2-methoxy-phenyl)-amide|3-chloro-N-(2-methoxyphenyl)-6-methyl-benzothiophene-2-carboxamide|3-chloro-6-methyl-N-[2-(methyloxy)phenyl]-1-benzothiophene-2-carboxamide|
3-Chloro-6-methyl-benzo[b]thiophene-2-carboxylic acid (2-methoxy-phenyl)-am ide
| Molecular Formula | C17H14ClNO2S |
|---|---|
| Molecular Weight | 331.04337 g/mol |
| LogP | 5.1 |
| Topological Polar Surface Area | 66.6 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 331.04337 |
| Monoisotopic Mass | 331.04337 |
| Heavy Atoms | 22 |
| Complexity | 408.0 |
Chemical Identifiers
| CAS Number | 312938-74-2 |
|---|---|
| SMILES | CC1=CC2=C(C=C1)C(=C(S2)C(=O)NC3=CC=CC=C3OC)Cl |
| InChIKey | REEDFDSAFBFJGS-UHFFFAOYSA-N |
Product Overview
3-Chloro-N-(2-methoxyphenyl)-6-methylbenzo[b]thiophene-2-carboxamide (CAS 312938-74-2), with molecular formula C17H14ClNO2S and molecular weight 331.04337 g/mol. IUPAC: 3-chloro-N-(2-methoxyphenyl)-6-methyl-1-benzothiophene-2-carboxamide.
3-Chloro-N-(2-methoxyphenyl)-6-methylbenzo[b]thiophene-2-carboxamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »