![4,5-Dimethyl-2-[(3-methylbenzoyl)amino]-3-thiophenecarboxylic acid structure](/static/products/3129/312940-71-9.webp)
4,5-Dimethyl-2-[(3-methylbenzoyl)amino]-3-thiophenecarboxylic acid
4,5-dimethyl-2-[(3-methylbenzoyl)amino]thiophene-3-carboxylic acid
Also Known As: Oprea1_347985|AE-848/37051056|4,5-dimethyl-2-[(3-methylbenzoyl)amino]-3-thiophenecarboxylic acid|4,5-dimethyl-2-[(3-methylbenzoyl)amino]thiophene-3-carboxylic acid|SR-01000438559-1|4,5-DIMETHYL-2-(3-METHYLBENZAMIDO)THIOPHENE-3-CARBOXYLIC ACID|4,5-dimethyl-2-{[(3-methylphenyl)carbonyl]amino}thiophene-3-carboxylic acid
| Molecular Formula | C15H15NO3S |
|---|---|
| Molecular Weight | 289.07727 g/mol |
| LogP | 4.0 |
| Topological Polar Surface Area | 94.6 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 289.07727 |
| Monoisotopic Mass | 289.07727 |
| Heavy Atoms | 20 |
| Complexity | 387.0 |
Chemical Identifiers
| CAS Number | 312940-71-9 |
|---|---|
| SMILES | CC1=CC(=CC=C1)C(=O)NC2=C(C(=C(S2)C)C)C(=O)O |
| InChIKey | JCEZHNZBOGZOGH-UHFFFAOYSA-N |
Product Overview
4,5-Dimethyl-2-[(3-methylbenzoyl)amino]-3-thiophenecarboxylic acid (CAS 312940-71-9), with molecular formula C15H15NO3S and molecular weight 289.07727 g/mol. IUPAC: 4,5-dimethyl-2-[(3-methylbenzoyl)amino]thiophene-3-carboxylic acid.
4,5-Dimethyl-2-[(3-methylbenzoyl)amino]-3-thiophenecarboxylic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »