1-(5-methoxy-2-methyl-1-(naphthalen-1-yl)-1H-indol-3-yl)ethanone
1-(5-methoxy-2-methyl-1-naphthalen-1-ylindol-3-yl)ethanone
Also Known As: 3-acetyl-5-methoxy-2-methyl-1-naphthylindole|SR-01000438609-1|1-(5-methoxy-2-methyl-1-naphthalen-1-ylindol-3-yl)ethanone|1-(5-methoxy-2-methyl-1-(naphthalen-1-yl)-1H-indol-3-yl)ethanone|1-[5-methoxy-2-methyl-1-(naphthalen-1-yl)-1H-indol-3-yl]ethanone|1-[5-METHOXY-2-METHYL-1-(NAPHTHALEN-1-YL)-1H-INDOL-3-YL]ETHAN-1-ONE
| Molecular Formula | C22H19NO2 |
|---|---|
| Molecular Weight | 329.14157 g/mol |
| LogP | 5.30332 |
| Topological Polar Surface Area | 31.23 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 329.14157 |
| Monoisotopic Mass | 329.14157 |
| Heavy Atoms | 25 |
| Complexity | 1116.4929 |
Chemical Identifiers
| CAS Number | 312945-63-4 |
|---|---|
| SMILES | CC1=C(C2=C(N1C3=CC=CC4=CC=CC=C43)C=CC(=C2)OC)C(=O)C |
Product Overview
1-(5-methoxy-2-methyl-1-(naphthalen-1-yl)-1H-indol-3-yl)ethanone (CAS 312945-63-4), with molecular formula C22H19NO2 and molecular weight 329.14157 g/mol. IUPAC: 1-(5-methoxy-2-methyl-1-naphthalen-1-ylindol-3-yl)ethanone.
1-(5-methoxy-2-methyl-1-(naphthalen-1-yl)-1H-indol-3-yl)ethanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »