AC1LGZZY
ethyl 5-[2-(6-hydroxy-3-methyl-1-benzofuran-2-yl)-2-oxoethyl]furan-2-carboxylate
Also Known As: ethyl 5-[2-(6-hydroxy-3-methyl-1-benzofuran-2-yl)-2-oxoethyl]furan-2-carboxylate|5-[2-(6-hydroxy-3-methyl-2-benzofuranyl)-2-oxoethyl]-2-furancarboxylic acid ethyl ester|ethyl 5-[2-(6-hydroxy-3-methyl-1-benzofuran-2-yl)-2-oxoethyl]-2-furoate|5-[2-(6-hydroxy-3-methyl-benzofuran-2-yl)-2-keto-ethyl]furan-2-carboxylic acid ethyl ester|ethyl 5-(2-(6-hydroxy-3-methylbenzofuran-2-yl)-2-oxoethyl)furan-2-carboxylate|ethyl 5-[2-(3-methyl-6-oxidanyl-1-benzofuran-2-yl)-2-oxidanylidene-ethyl]furan-2-carboxylate
| Molecular Formula | C18H16O6 |
|---|---|
| Molecular Weight | 328.0947 g/mol |
| LogP | 3.64192 |
| Topological Polar Surface Area | 89.88 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Exact Mass | 328.0947 |
| Monoisotopic Mass | 328.0947 |
| Heavy Atoms | 24 |
| Complexity | 914.8818 |
Chemical Identifiers
| CAS Number | 313261-75-5 |
|---|---|
| SMILES | CCOC(=O)C1=CC=C(O1)CC(=O)C2=C(C3=C(O2)C=C(C=C3)O)C |
Product Overview
AC1LGZZY (CAS 313261-75-5), with molecular formula C18H16O6 and molecular weight 328.0947 g/mol. IUPAC: ethyl 5-[2-(6-hydroxy-3-methyl-1-benzofuran-2-yl)-2-oxoethyl]furan-2-carboxylate.