Methyl 2-(furan-2-carbonylamino)-4,5-dimethoxybenzoate
methyl 2-(furan-2-carbonylamino)-4,5-dimethoxybenzoate
Also Known As: Oprea1_202246|CBDivE_002274|BAS 08979214|Methyl 2-(2-furoylamino)-4,5-dimethoxybenzoate|methyl 2-(furan-2-carboxamido)-4,5-dimethoxybenzoate|methyl 2-(furan-2-carbonylamino)-4,5-dimethoxybenzoate|methyl 2-(2-furylcarbonylamino)-4,5-dimethoxybenzoate|2-(2-furoylamino)-4,5-dimethoxy-benzoic acid methyl ester|methyl 2-(furan-2-ylcarbonylamino)-4,5-dimethoxy-benzoate|methyl 2-[(furan-2-ylcarbonyl)amino]-4,5-dimethoxybenzoate|2-[(Furan-2-carbonyl)-amino]-4,5-dimethoxy-benzoic acid methyl ester|2-[[2-furanyl(oxo)methyl]amino]-4,5-dimethoxybenzoic acid methyl ester
| Molecular Formula | C15H15NO6 |
|---|---|
| Molecular Weight | 305.08994 g/mol |
| LogP | 2.3357 |
| Topological Polar Surface Area | 87.0 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Exact Mass | 305.08994 |
| Monoisotopic Mass | 305.08994 |
| Heavy Atoms | 22 |
| Complexity | 677.5912 |
Chemical Identifiers
| CAS Number | 313375-80-3 |
|---|---|
| SMILES | COC1=C(C=C(C(=C1)C(=O)OC)NC(=O)C2=CC=CO2)OC |
Product Overview
Methyl 2-(furan-2-carbonylamino)-4,5-dimethoxybenzoate (CAS 313375-80-3), with molecular formula C15H15NO6 and molecular weight 305.08994 g/mol. IUPAC: methyl 2-(furan-2-carbonylamino)-4,5-dimethoxybenzoate.