4-Chloro-2-((triphenylphosphoranyl)methyl)benzenesulfonyl fluoride
4-chloro-2-[(triphenyl-λ5-phosphanylidene)methyl]benzenesulfonyl fluoride
Also Known As: 4-chloro-2-[(triphenyl-|4-Chloro-2-((triphenylphosphoranyl)methyl)benzenesulfonyl fluoride|Phosphonium, [[5-chloro-2-(fluorosulfonyl)phenyl]methyl]triphenyl-|4-chloro-2-[(triphenyl-$l^{5}-phosphanylidene)methyl]benzenesulfonyl fluoride|Phosphonium, {[[5-chloro-2-(fluorosulfonyl)phenyl]methyl]triphenyl-,} bromide
| Molecular Formula | C25H19ClFO2PS |
|---|---|
| Molecular Weight | 468.0516 g/mol |
| LogP | 5.8 |
| Topological Polar Surface Area | 42.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 468.0516 |
| Monoisotopic Mass | 468.0516 |
| Heavy Atoms | 31 |
| Complexity | 679.0 |
Chemical Identifiers
| CAS Number | 31362-40-0 |
|---|---|
| SMILES | C1=CC=C(C=C1)P(=CC2=C(C=CC(=C2)Cl)S(=O)(=O)F)(C3=CC=CC=C3)C4=CC=CC=C4 |
| InChIKey | IWLDTGFRCIZGBB-UHFFFAOYSA-N |
Product Overview
4-Chloro-2-((triphenylphosphoranyl)methyl)benzenesulfonyl fluoride (CAS 31362-40-0), with molecular formula C25H19ClFO2PS and molecular weight 468.0516 g/mol. IUPAC: 4-chloro-2-[(triphenyl-λ5-phosphanylidene)methyl]benzenesulfonyl fluoride.
4-Chloro-2-((triphenylphosphoranyl)methyl)benzenesulfonyl fluoride is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »