N-(4-fluorophenyl)-6-methoxy-2-oxo-2H-chromene-3-carboxamide
N-(4-fluorophenyl)-6-methoxy-2-oxochromene-3-carboxamide
Also Known As: Oprea1_586038|Oprea1_720008|BAS 01126790|SR-01000398002-1|6-Methoxy-2-oxo-2H-chromene-3-carboxylic acid (4-fluoro-phenyl)-amide|N-(4-fluorophenyl)-6-methoxy-2-oxo-2H-chromene-3-carboxamide|N-(4-fluorophenyl)(6-methoxy-2-oxochromen-3-yl)carboxamide|N-(4-fluorophenyl)-6-methoxy-2-oxochromene-3-carboxamide
| Molecular Formula | C17H12FNO4 |
|---|---|
| Molecular Weight | 313.07504 g/mol |
| LogP | 3.0 |
| Topological Polar Surface Area | 64.6 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 313.07504 |
| Monoisotopic Mass | 313.07504 |
| Heavy Atoms | 23 |
| Complexity | 499.0 |
Chemical Identifiers
| CAS Number | 313669-46-4 |
|---|---|
| SMILES | COC1=CC2=C(C=C1)OC(=O)C(=C2)C(=O)NC3=CC=C(C=C3)F |
| InChIKey | DYPBGLQPWCEBRJ-UHFFFAOYSA-N |
Product Overview
N-(4-fluorophenyl)-6-methoxy-2-oxo-2H-chromene-3-carboxamide (CAS 313669-46-4), with molecular formula C17H12FNO4 and molecular weight 313.07504 g/mol. IUPAC: N-(4-fluorophenyl)-6-methoxy-2-oxochromene-3-carboxamide.
N-(4-fluorophenyl)-6-methoxy-2-oxo-2H-chromene-3-carboxamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »