methyl 2-{[2-(diethylamino)-2-oxoethyl]sulfanyl}-1H-benzimidazole-1-carboxylate
methyl 2-[2-(diethylamino)-2-oxoethyl]sulfanylbenzimidazole-1-carboxylate
Also Known As: Oprea1_678774|AG-205/36523030|SR-01000398134-1|A1131/0052849|methyl 2-{[2-(diethylamino)-2-oxoethyl]sulfanyl}-1H-benzimidazole-1-carboxylate|methyl 2-[2-(diethylamino)-2-oxoethyl]sulfanylbenzimidazole-1-carboxylate|methyl 2-((2-(diethylamino)-2-oxoethyl)thio)-1H-benzo[d]imidazole-1-carboxylate|METHYL 2-{[(DIETHYLCARBAMOYL)METHYL]SULFANYL}-1H-1,3-BENZODIAZOLE-1-CARBOXYLATE
| Molecular Formula | C15H19N3O3S |
|---|---|
| Molecular Weight | 321.11472 g/mol |
| LogP | 2.8 |
| Topological Polar Surface Area | 89.7 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Exact Mass | 321.11472 |
| Monoisotopic Mass | 321.11472 |
| Heavy Atoms | 22 |
| Complexity | 403.0 |
Chemical Identifiers
| CAS Number | 313670-18-7 |
|---|---|
| SMILES | CCN(CC)C(=O)CSC1=NC2=CC=CC=C2N1C(=O)OC |
| InChIKey | USIQDEPGMTTWME-UHFFFAOYSA-N |
Product Overview
methyl 2-{[2-(diethylamino)-2-oxoethyl]sulfanyl}-1H-benzimidazole-1-carboxylate (CAS 313670-18-7), with molecular formula C15H19N3O3S and molecular weight 321.11472 g/mol. IUPAC: methyl 2-[2-(diethylamino)-2-oxoethyl]sulfanylbenzimidazole-1-carboxylate.
methyl 2-{[2-(diethylamino)-2-oxoethyl]sulfanyl}-1H-benzimidazole-1-carboxylate is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »