![3-[(4-Chlorophenoxy)methyl]-4-methoxybenzaldehyde structure](/static/products/3137/313701-97-2.webp)
3-[(4-Chlorophenoxy)methyl]-4-methoxybenzaldehyde
3-[(4-chlorophenoxy)methyl]-4-methoxybenzaldehyde
Also Known As: 3-[(4-Chlorophenoxy)methyl]-4-methoxybenzaldehyde|Oprea1_281670|3-(4-chlorophenoxymethyl)-4-methoxybenzaldehyde|3-((4-Chlorophenoxy)methyl)-4-methoxybenzaldehyde|3-(4-chloro-phenoxymethyl)-4-methoxy-benzaldehyde|3-(4-Chloro-phenoxymethyl)-4-methoxybenzaldehyde|3-[(4-chlorophenoxy)methyl]-4-methoxy-benzaldehyde|Benzaldehyde, 3-(4-chlorophenoxymethyl)-4-methoxy-|3-(2,5-Dimethyl-pyrrol-1-yl)-4-methoxy-phenylamine|3-[(4-Chlorophenoxy)methyl]-4-methoxybenzaldehyde #
| Molecular Formula | C15H13ClO3 |
|---|---|
| Molecular Weight | 276.05533 g/mol |
| LogP | 3.4 |
| Topological Polar Surface Area | 35.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 276.05533 |
| Monoisotopic Mass | 276.05533 |
| Heavy Atoms | 19 |
| Complexity | 277.0 |
Chemical Identifiers
| CAS Number | 313701-97-2 |
|---|---|
| SMILES | COC1=C(C=C(C=C1)C=O)COC2=CC=C(C=C2)Cl |
| InChIKey | DTLLHBACWDTJEK-UHFFFAOYSA-N |
Product Overview
3-[(4-Chlorophenoxy)methyl]-4-methoxybenzaldehyde (CAS 313701-97-2), with molecular formula C15H13ClO3 and molecular weight 276.05533 g/mol. IUPAC: 3-[(4-chlorophenoxy)methyl]-4-methoxybenzaldehyde.
3-[(4-Chlorophenoxy)methyl]-4-methoxybenzaldehyde is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »